1,3-Dimethylimidazolidin-2-one
Simulation outputs:
Parameter | Value | |
Field strength | 600.01(MHz) | |
RMSD of the fit | 0.01676 | |
Temperature | 298 K | |
pH | 7.4 | |
InChI | InChI=1S/C5H10N2O/c1-6-3-4-7(2)5(6)8/h3-4H2,1-2H3 | |
Note 1 | None |
Sample description:
Compound | Type | Concentration |
---|---|---|
1,3-Dimethylimidazolidin-2-one | Solute | 75uM |
DSS | Reference | 15uM |
bis-Tris-d19 | Buffer | 11mM |
NaCl | . | 150mM |
NaN3 | . | 0.04%. |
Na Formate | . | 200uM |
Spin System Matrix
9 | 10 | 11 | 12 | 13 | 14 | 15 | 16 | 17 | 18 | |
---|---|---|---|---|---|---|---|---|---|---|
9 | 2.721 | -14.0 | -14.0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
10 | 0 | 2.721 | -14.0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
11 | 0 | 0 | 2.721 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
12 | 0 | 0 | 0 | 2.721 | -14.0 | -14.0 | 0 | 0 | 0 | 0 |
13 | 0 | 0 | 0 | 0 | 2.721 | -14.0 | 0 | 0 | 0 | 0 |
14 | 0 | 0 | 0 | 0 | 0 | 2.721 | 0 | 0 | 0 | 0 |
15 | 0 | 0 | 0 | 0 | 0 | 0 | 3.352 | -14.0 | 6.7 | 6.7 |
16 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 3.352 | 6.7 | 6.7 |
17 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 3.352 | -14.0 |
18 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 3.352 |
Spectra
Select field strength to view simulated spectra and peak lists (standard and GSD): Autoscale
Help
To zoom into a region, draw a box around it.Hover over the x/y-axis and use mouse-wheel to zoom in/out.
Hover over the x/y-axis hold down left-button to move around the spectra.
(De)activate a spectrum by clicking on its legend.
PPM | Amplitude | Peak Type |
---|---|---|
2.72097 | 1.0 | standard |
3.35199 | 0.667107 | standard |
2.72097 | 1.0 | standard |
3.35199 | 0.667859 | standard |
2.72097 | 1.0 | standard |
3.35199 | 0.667615 | standard |
2.72097 | 1.0 | standard |
3.35199 | 0.66765 | standard |
2.72097 | 1.0 | standard |
3.35199 | 0.667707 | standard |
2.72097 | 1.0 | standard |
3.35199 | 0.667118 | standard |
2.72097 | 1.0 | standard |
3.35199 | 0.667368 | standard |
2.72097 | 1.0 | standard |
3.35199 | 0.667519 | standard |
2.72097 | 1.0 | standard |
3.35199 | 0.667206 | standard |
2.72097 | 1.0 | standard |
3.35199 | 0.667252 | standard |
2.72097 | 1.0 | standard |
3.35199 | 0.666763 | standard |
2.72097 | 1.0 | standard |
3.35199 | 0.66686 | standard |
2.72097 | 1.0 | standard |
3.35199 | 0.667972 | standard |
2.72097 | 1.0 | standard |
3.35199 | 0.667479 | standard |
2.72097 | 1.0 | standard |
3.35199 | 0.667349 | standard |
2.72097 | 1.0 | standard |
3.35199 | 0.666829 | standard |
2.72097 | 1.0 | standard |
3.35199 | 0.667854 | standard |
2.72097 | 1.0 | standard |
3.35199 | 0.667268 | standard |